C34H41N3O4S — CID 23754280
(5S,6S,7R)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-6-N-phenyl-2-N-propan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754280) has the molecular formula C34H41N3O4S and a molecular weight of 587.79 g/mol. Its IUPAC name is (5S,6S,7R)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-6-N-phenyl-2-N-propan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-6-N-phenyl-2-N-propan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754280 |
| Molecular Formula | C34H41N3O4S |
| Molecular Weight | 587.79 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | (5S,6S,7R)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-6-N-phenyl-2-N-propan-2-yl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)[C@@H]1[C@H]2C(=O)N([C@@H](CO)Cc3ccccc3)C(C(=O)N(CC=C)C(C)C)C23CC[C@H]1S3)c1ccccc1 |
| InChI | InChI=1S/C34H41N3O4S/c1-5-19-35(23(3)4)33(41)30-34-18-17-27(42-34)28(31(39)36(20-6-2)25-15-11-8-12-16-25)29(34)32(40)37(30)26(22-38)21-24-13-9-7-10-14-24/h5-16,23,26-30,38H,1-2,17-22H2,3-4H3/t26-,27-,28+,29+,30?,34?/m1/s1 |
| InChIKey | PRKBTEZACZLQKH-FWQDFXIUSA-N |
| XLogP | 4.32 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.79 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|