C26H38BrN3O4S — CID 23925656
(5S,6R,7R)-8-bromo-2-N-cyclohexyl-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925656) has the molecular formula C26H38BrN3O4S and a molecular weight of 568.58 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-2-N-cyclohexyl-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-2-N-cyclohexyl-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925656 |
| Molecular Formula | C26H38BrN3O4S |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | (5S,6R,7R)-8-bromo-2-N-cyclohexyl-3-[(2R)-1-hydroxypropan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N([C@H](C)CO)C(C(=O)N(CC=C)C3CCCCC3)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C26H38BrN3O4S/c1-5-12-28(4)23(32)19-20-24(33)30(16(3)15-31)22(26(20)14-18(27)21(19)35-26)25(34)29(13-6-2)17-10-8-7-9-11-17/h5-6,16-22,31H,1-2,7-15H2,3-4H3/t16-,18?,19+,20+,21+,22?,26?/m1/s1 |
| InChIKey | BHLGGONIUXYUKE-PCVIRBBHSA-N |
| XLogP | 2.82 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|