C30H48BrN3O4S — CID 23953530
(5S,6R,7R)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953530) has the molecular formula C30H48BrN3O4S and a molecular weight of 626.70 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953530 |
| Molecular Formula | C30H48BrN3O4S |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | (5S,6R,7R)-8-bromo-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@H]1[C@H]2C(=O)N([C@H](C)CO)C(C(=O)N(CC=C)C(C)(C)CC(C)(C)C)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C30H48BrN3O4S/c1-10-13-32(14-11-2)25(36)21-22-26(37)34(19(4)17-35)24(30(22)16-20(31)23(21)39-30)27(38)33(15-12-3)29(8,9)18-28(5,6)7/h10,12,19-24,35H,1,3,11,13-18H2,2,4-9H3/t19-,20?,21+,22+,23+,24?,30?/m1/s1 |
| InChIKey | ALACSXXNPDCXOY-IKEQVFBDSA-N |
| XLogP | 4.49 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|