C29H44BrN3O4S — CID 23754579
(5S,6R,7R)-8-bromo-2-N-cyclohexyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754579) has the molecular formula C29H44BrN3O4S and a molecular weight of 610.66 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-2-N-cyclohexyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-2-N-cyclohexyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754579 |
| Molecular Formula | C29H44BrN3O4S |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | (5S,6R,7R)-8-bromo-2-N-cyclohexyl-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)N(CC=C)C3CCCCC3)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C29H44BrN3O4S/c1-6-14-31(5)26(35)22-23-27(36)33(21(17-34)18(4)8-3)25(29(23)16-20(30)24(22)38-29)28(37)32(15-7-2)19-12-10-9-11-13-19/h6-7,18-25,34H,1-2,8-17H2,3-5H3/t18-,20?,21-,22-,23-,24-,25?,29?/m0/s1 |
| InChIKey | KQHVAYPGAUNSMV-NIOGERMRSA-N |
| XLogP | 3.85 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|