C27H42BrN3O4S — CID 23812981
(5S,6S,7S)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23812981) has the molecular formula C27H42BrN3O4S and a molecular weight of 584.62 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23812981 |
| Molecular Formula | C27H42BrN3O4S |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | (5S,6S,7S)-8-bromo-2-N-tert-butyl-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N-methyl-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)N(CC=C)C(C)(C)C)N([C@@H](CO)CC(C)C)C(=O)[C@H]13 |
| InChI | InChI=1S/C27H42BrN3O4S/c1-9-11-29(8)23(33)19-20-24(34)31(17(15-32)13-16(3)4)22(27(20)14-18(28)21(19)36-27)25(35)30(12-10-2)26(5,6)7/h9-10,16-22,32H,1-2,11-15H2,3-8H3/t17-,18?,19-,20+,21-,22?,27?/m1/s1 |
| InChIKey | PXWXDFIRYJSYFX-WVOGOPTKSA-N |
| XLogP | 3.32 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|