C29H37BrN2O5S — CID 23810825
but-3-enyl (5S,6R,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23810825) has the molecular formula C29H37BrN2O5S and a molecular weight of 605.60 g/mol. Its IUPAC name is but-3-enyl (5S,6R,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5S,6R,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23810825 |
| Molecular Formula | C29H37BrN2O5S |
| Molecular Weight | 605.60 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | but-3-enyl (5S,6R,7R)-8-bromo-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@H]2C(=O)N([C@H](CO)c3ccccc3)C(C(=O)N(CC=C)C(C)(C)C)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C29H37BrN2O5S/c1-6-8-15-37-27(36)21-22-25(34)32(20(17-33)18-12-10-9-11-13-18)24(29(22)16-19(30)23(21)38-29)26(35)31(14-7-2)28(3,4)5/h6-7,9-13,19-24,33H,1-2,8,14-17H2,3-5H3/t19?,20-,21+,22+,23+,24?,29?/m1/s1 |
| InChIKey | YMZRHWLYKRFXEP-XBBDHCRCSA-N |
| XLogP | 4.12 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|