C26H43BrN2O5S — CID 23751954
ethyl (5S,6R,7R)-8-bromo-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23751954) has the molecular formula C26H43BrN2O5S and a molecular weight of 575.61 g/mol. Its IUPAC name is ethyl (5S,6R,7R)-8-bromo-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7R)-8-bromo-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23751954 |
| Molecular Formula | C26H43BrN2O5S |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | ethyl (5S,6R,7R)-8-bromo-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)NC(C)(C)CC(C)(C)C)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C26H43BrN2O5S/c1-9-14(3)16(12-30)29-20(21(31)28-25(7,8)13-24(4,5)6)26-11-15(27)19(35-26)17(18(26)22(29)32)23(33)34-10-2/h14-20,30H,9-13H2,1-8H3,(H,28,31)/t14-,15?,16-,17-,18-,19-,20?,26?/m0/s1 |
| InChIKey | DNQBISCWWQGCJL-ZCCBOZCNSA-N |
| XLogP | 3.75 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|