C28H40BrN3O4S — CID 23812957
(5S,6R,7R)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-6-N-phenyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23812957) has the molecular formula C28H40BrN3O4S and a molecular weight of 594.62 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-6-N-phenyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-6-N-phenyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23812957 |
| Molecular Formula | C28H40BrN3O4S |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | (5S,6R,7R)-8-bromo-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-6-N-phenyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCC(CO)N1C(=O)[C@@H]2[C@H](C(=O)Nc3ccccc3)[C@H]3SC2(CC3Br)C1C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C28H40BrN3O4S/c1-7-17(14-33)32-22(24(35)31-27(5,6)15-26(2,3)4)28-13-18(29)21(37-28)19(20(28)25(32)36)23(34)30-16-11-9-8-10-12-16/h8-12,17-22,33H,7,13-15H2,1-6H3,(H,30,34)(H,31,35)/t17?,18?,19-,20-,21-,22?,28?/m0/s1 |
| InChIKey | USNURTDHOSECTM-LSKYBMIGSA-N |
| XLogP | 4.19 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|