C32H41BrN4O5S — CID 23897922
(5S,6S,7S)-8-bromo-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897922) has the molecular formula C32H41BrN4O5S and a molecular weight of 673.67 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897922 |
| Molecular Formula | C32H41BrN4O5S |
| Molecular Weight | 673.67 g/mol |
| Exact Mass | 672.20 |
| IUPAC Name | (5S,6S,7S)-8-bromo-2-N-[4-(diethylamino)phenyl]-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@@H]3SC4(CC3Br)C(C(=O)Nc3ccc(N(CC)CC)cc3)N([C@@H](CC)CO)C(=O)[C@H]24)cc1 |
| InChI | InChI=1S/C32H41BrN4O5S/c1-5-21(18-38)37-28(30(40)35-19-9-13-22(14-10-19)36(6-2)7-3)32-17-24(33)27(43-32)25(26(32)31(37)41)29(39)34-20-11-15-23(16-12-20)42-8-4/h9-16,21,24-28,38H,5-8,17-18H2,1-4H3,(H,34,39)(H,35,40)/t21-,24?,25+,26-,27+,28?,32?/m0/s1 |
| InChIKey | PQDWFZQKNVUBQK-TZBZNTRRSA-N |
| XLogP | 4.74 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|