C28H32BrN3O5S — CID 23925646
(5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925646) has the molecular formula C28H32BrN3O5S and a molecular weight of 602.55 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925646 |
| Molecular Formula | C28H32BrN3O5S |
| Molecular Weight | 602.55 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | (5S,6R,7R)-8-bromo-2-N-(2,6-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N(CCO)C(C(=O)Nc4c(C)cccc4C)C34CC(Br)[C@@H]2S4)cc1 |
| InChI | InChI=1S/C28H32BrN3O5S/c1-4-37-18-10-8-17(9-11-18)30-25(34)20-21-27(36)32(12-13-33)24(28(21)14-19(29)23(20)38-28)26(35)31-22-15(2)6-5-7-16(22)3/h5-11,19-21,23-24,33H,4,12-14H2,1-3H3,(H,30,34)(H,31,35)/t19?,20-,21-,23-,24?,28?/m0/s1 |
| InChIKey | OZAMTBPLZRLYKS-WYGDPNIXSA-N |
| XLogP | 3.74 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|