C22H27BrN2O5S — CID 23950690
ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23950690) has the molecular formula C22H27BrN2O5S and a molecular weight of 511.44 g/mol. Its IUPAC name is ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23950690 |
| Molecular Formula | C22H27BrN2O5S |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-(2-hydroxyethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)Nc2cc(C)ccc2C)N(CCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C22H27BrN2O5S/c1-4-30-21(29)15-16-20(28)25(7-8-26)18(22(16)10-13(23)17(15)31-22)19(27)24-14-9-11(2)5-6-12(14)3/h5-6,9,13,15-18,26H,4,7-8,10H2,1-3H3,(H,24,27)/t13?,15-,16+,17-,18?,22?/m1/s1 |
| InChIKey | JFBYPPGAHBJMPM-TYMCPQIHSA-N |
| XLogP | 2.26 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|