C24H31BrN2O5S — CID 23978728
ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23978728) has the molecular formula C24H31BrN2O5S and a molecular weight of 539.49 g/mol. Its IUPAC name is ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23978728 |
| Molecular Formula | C24H31BrN2O5S |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)Nc2cc(C)ccc2C)N([C@@H](CC)CO)C(=O)[C@H]13 |
| InChI | InChI=1S/C24H31BrN2O5S/c1-5-14(11-28)27-20(21(29)26-16-9-12(3)7-8-13(16)4)24-10-15(25)19(33-24)17(18(24)22(27)30)23(31)32-6-2/h7-9,14-15,17-20,28H,5-6,10-11H2,1-4H3,(H,26,29)/t14-,15?,17+,18-,19+,20?,24?/m0/s1 |
| InChIKey | LYXZVRPAEZOLSH-WTUHCQSPSA-N |
| XLogP | 3.04 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|