C29H34BrN3O4S — CID 23925771
(5S,6R,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925771) has the molecular formula C29H34BrN3O4S and a molecular weight of 600.58 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925771 |
| Molecular Formula | C29H34BrN3O4S |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | (5S,6R,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@H]1[C@H]2C(=O)N([C@H](CO)c3ccccc3)C(C(=O)Nc3cc(C)ccc3C)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C29H34BrN3O4S/c1-4-12-31-26(35)22-23-28(37)33(21(15-34)18-8-6-5-7-9-18)25(29(23)14-19(30)24(22)38-29)27(36)32-20-13-16(2)10-11-17(20)3/h5-11,13,19,21-25,34H,4,12,14-15H2,1-3H3,(H,31,35)(H,32,36)/t19?,21-,22+,23+,24+,25?,29?/m1/s1 |
| InChIKey | MPRHEXCMMQNMMU-FMXBPLRCSA-N |
| XLogP | 3.97 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|