C27H30BrN3O4S — CID 23813090
(5S,6S,7S)-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813090) has the molecular formula C27H30BrN3O4S and a molecular weight of 572.53 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813090 |
| Molecular Formula | C27H30BrN3O4S |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | (5S,6S,7S)-8-bromo-2-N-(2,6-dimethylphenyl)-3-[(1S)-2-hydroxy-1-phenylethyl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)Nc2c(C)cccc2C)N([C@H](CO)c2ccccc2)C(=O)[C@H]13 |
| InChI | InChI=1S/C27H30BrN3O4S/c1-14-8-7-9-15(2)21(14)30-25(34)23-27-12-17(28)22(36-27)19(24(33)29-3)20(27)26(35)31(23)18(13-32)16-10-5-4-6-11-16/h4-11,17-20,22-23,32H,12-13H2,1-3H3,(H,29,33)(H,30,34)/t17?,18-,19-,20+,22-,23?,27?/m1/s1 |
| InChIKey | YKUCZGKCBOTGJX-JSSYEUJXSA-N |
| XLogP | 3.19 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|