C24H32BrN3O4S — CID 23925861
(5S,6S,7S)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925861) has the molecular formula C24H32BrN3O4S and a molecular weight of 538.51 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925861 |
| Molecular Formula | C24H32BrN3O4S |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | (5S,6S,7S)-8-bromo-2-N-(2,6-dimethylphenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)Nc2c(C)cccc2C)N(CCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C24H32BrN3O4S/c1-13-8-7-9-14(2)18(13)27-22(31)20-24-12-15(25)19(33-24)16(21(30)26-3)17(24)23(32)28(20)10-5-4-6-11-29/h7-9,15-17,19-20,29H,4-6,10-12H2,1-3H3,(H,26,30)(H,27,31)/t15?,16-,17+,19-,20?,24?/m1/s1 |
| InChIKey | LCPRNLIFPSWWQJ-JKVHNBDESA-N |
| XLogP | 2.62 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|