C20H23BrClN3O4S — CID 23812920
(5S,6R,7R)-8-bromo-2-N-(4-chlorophenyl)-3-(3-hydroxypropyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23812920) has the molecular formula C20H23BrClN3O4S and a molecular weight of 516.85 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-2-N-(4-chlorophenyl)-3-(3-hydroxypropyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-2-N-(4-chlorophenyl)-3-(3-hydroxypropyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23812920 |
| Molecular Formula | C20H23BrClN3O4S |
| Molecular Weight | 516.85 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | (5S,6R,7R)-8-bromo-2-N-(4-chlorophenyl)-3-(3-hydroxypropyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@H]2C(=O)N(CCCO)C(C(=O)Nc3ccc(Cl)cc3)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C20H23BrClN3O4S/c1-23-17(27)13-14-19(29)25(7-2-8-26)16(20(14)9-12(21)15(13)30-20)18(28)24-11-5-3-10(22)4-6-11/h3-6,12-16,26H,2,7-9H2,1H3,(H,23,27)(H,24,28)/t12?,13-,14-,15-,16?,20?/m0/s1 |
| InChIKey | ODFGUZSPQHRHGR-UNCPFUEXSA-N |
| XLogP | 1.87 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.85 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|