C18H28BrN3O4S — CID 23813070
(5S,6S,7S)-8-bromo-2-N-butyl-3-(3-hydroxypropyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813070) has the molecular formula C18H28BrN3O4S and a molecular weight of 462.41 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-2-N-butyl-3-(3-hydroxypropyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-2-N-butyl-3-(3-hydroxypropyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813070 |
| Molecular Formula | C18H28BrN3O4S |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (5S,6S,7S)-8-bromo-2-N-butyl-3-(3-hydroxypropyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)C1N(CCCO)C(=O)[C@@H]2[C@@H](C(=O)NC)[C@@H]3SC12CC3Br |
| InChI | InChI=1S/C18H28BrN3O4S/c1-3-4-6-21-16(25)14-18-9-10(19)13(27-18)11(15(24)20-2)12(18)17(26)22(14)7-5-8-23/h10-14,23H,3-9H2,1-2H3,(H,20,24)(H,21,25)/t10?,11-,12+,13-,14?,18?/m1/s1 |
| InChIKey | JGJWISBXDXYOFH-ZVSXXVAUSA-N |
| XLogP | 0.50 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|