C27H46BrN3O4S — CID 23925875
(5S,6S,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925875) has the molecular formula C27H46BrN3O4S and a molecular weight of 588.65 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925875 |
| Molecular Formula | C27H46BrN3O4S |
| Molecular Weight | 588.65 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | (5S,6S,7S)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)NC(C)(C)CC(C)(C)C)N(CCCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C27H46BrN3O4S/c1-7-12-29-22(33)18-19-24(35)31(13-10-8-9-11-14-32)21(27(19)15-17(28)20(18)36-27)23(34)30-26(5,6)16-25(2,3)4/h17-21,32H,7-16H2,1-6H3,(H,29,33)(H,30,34)/t17?,18-,19+,20-,21?,27?/m1/s1 |
| InChIKey | CJZLZCRKTLZTSF-KCRFOGGVSA-N |
| XLogP | 3.86 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|