C21H34BrN3O4S — CID 23869773
(5S,6R,7R)-8-bromo-2-N-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869773) has the molecular formula C21H34BrN3O4S and a molecular weight of 504.49 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-2-N-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-2-N-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869773 |
| Molecular Formula | C21H34BrN3O4S |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | (5S,6R,7R)-8-bromo-2-N-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)NC)[C@H]3SC12CC3Br |
| InChI | InChI=1S/C21H34BrN3O4S/c1-3-4-9-24-19(28)17-21-12-13(22)16(30-21)14(18(27)23-2)15(21)20(29)25(17)10-7-5-6-8-11-26/h13-17,26H,3-12H2,1-2H3,(H,23,27)(H,24,28)/t13?,14-,15-,16-,17?,21?/m0/s1 |
| InChIKey | ZZEWDTFLOAMPKE-HKXKBOTHSA-N |
| XLogP | 1.67 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|