C21H35N3O4S — CID 25091226
(5S,6R,7S)-2-N-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25091226) has the molecular formula C21H35N3O4S and a molecular weight of 425.60 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25091226 |
| Molecular Formula | C21H35N3O4S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | (5S,6R,7S)-2-N-butyl-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)NC)[C@@H]3CCC12S3 |
| InChI | InChI=1S/C21H35N3O4S/c1-3-4-11-23-19(27)17-21-10-9-14(29-21)15(18(26)22-2)16(21)20(28)24(17)12-7-5-6-8-13-25/h14-17,25H,3-13H2,1-2H3,(H,22,26)(H,23,27)/t14-,15+,16-,17?,21?/m0/s1 |
| InChIKey | DVIZFVKJTLNXJV-KLCLUDIMSA-N |
| XLogP | 1.29 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|