C22H37N3O4S — CID 25090185
(5S,6R,7S)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25090185) has the molecular formula C22H37N3O4S and a molecular weight of 439.62 g/mol. Its IUPAC name is (5S,6R,7S)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25090185 |
| Molecular Formula | C22H37N3O4S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (5S,6R,7S)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-2-N-pentyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCCNC(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)NC)[C@@H]3CCC12S3 |
| InChI | InChI=1S/C22H37N3O4S/c1-3-4-7-12-24-20(28)18-22-11-10-15(30-22)16(19(27)23-2)17(22)21(29)25(18)13-8-5-6-9-14-26/h15-18,26H,3-14H2,1-2H3,(H,23,27)(H,24,28)/t15-,16+,17-,18?,22?/m0/s1 |
| InChIKey | LEDCTFLZRZPCGM-YFXBJVGISA-N |
| XLogP | 1.68 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|