C20H33N3O4S — CID 25079500
(5S,6R,7S)-2-N-butyl-3-(3-hydroxypropyl)-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25079500) has the molecular formula C20H33N3O4S and a molecular weight of 411.57 g/mol. Its IUPAC name is (5S,6R,7S)-2-N-butyl-3-(3-hydroxypropyl)-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-N-butyl-3-(3-hydroxypropyl)-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25079500 |
| Molecular Formula | C20H33N3O4S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (5S,6R,7S)-2-N-butyl-3-(3-hydroxypropyl)-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCCNC(=O)C1N(CCCO)C(=O)[C@@H]2[C@H](C(=O)NCCC)[C@@H]3CCC12S3 |
| InChI | InChI=1S/C20H33N3O4S/c1-3-5-10-22-18(26)16-20-8-7-13(28-20)14(17(25)21-9-4-2)15(20)19(27)23(16)11-6-12-24/h13-16,24H,3-12H2,1-2H3,(H,21,25)(H,22,26)/t13-,14+,15-,16?,20?/m0/s1 |
| InChIKey | XETCQVVIGCACDY-STKAUHGPSA-N |
| XLogP | 0.90 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|