C23H29BrClN3O4S — CID 23754775
(5S,6S,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754775) has the molecular formula C23H29BrClN3O4S and a molecular weight of 558.93 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754775 |
| Molecular Formula | C23H29BrClN3O4S |
| Molecular Weight | 558.93 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | (5S,6S,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)Nc2ccccc2Cl)N(CCCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C23H29BrClN3O4S/c1-26-20(30)16-17-22(32)28(10-6-2-3-7-11-29)19(23(17)12-13(24)18(16)33-23)21(31)27-15-9-5-4-8-14(15)25/h4-5,8-9,13,16-19,29H,2-3,6-7,10-12H2,1H3,(H,26,30)(H,27,31)/t13?,16-,17+,18-,19?,23?/m1/s1 |
| InChIKey | PVGWPWVNYVOGJY-PULPQDARSA-N |
| XLogP | 3.04 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.93 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|