C23H30ClN3O5 — CID 23868516
(5R,6S,7S)-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23868516) has the molecular formula C23H30ClN3O5 and a molecular weight of 463.96 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23868516 |
| Molecular Formula | C23H30ClN3O5 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (5R,6S,7S)-2-N-(2-chlorophenyl)-3-(6-hydroxyhexyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)Nc2ccccc2Cl)N(CCCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C23H30ClN3O5/c1-25-20(29)17-16-10-11-23(32-16)18(17)22(31)27(12-6-2-3-7-13-28)19(23)21(30)26-15-9-5-4-8-14(15)24/h4-5,8-9,16-19,28H,2-3,6-7,10-13H2,1H3,(H,25,29)(H,26,30)/t16-,17+,18-,19?,23?/m0/s1 |
| InChIKey | ZUZNDKINXRCJPY-MQEWTYCZSA-N |
| XLogP | 1.95 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|