C22H27BrClN3O5 — CID 23813315
(5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813315) has the molecular formula C22H27BrClN3O5 and a molecular weight of 528.83 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813315 |
| Molecular Formula | C22H27BrClN3O5 |
| Molecular Weight | 528.83 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-N-(2-chlorophenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@@H]2OC3(CC2Br)C(C(=O)Nc2ccccc2Cl)N(CCCCCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C22H27BrClN3O5/c1-25-19(29)15-16-21(31)27(9-5-2-6-10-28)18(22(16)11-12(23)17(15)32-22)20(30)26-14-8-4-3-7-13(14)24/h3-4,7-8,12,15-18,28H,2,5-6,9-11H2,1H3,(H,25,29)(H,26,30)/t12?,15-,16+,17-,18?,22?/m1/s1 |
| InChIKey | LVLSMWKCKBMSGI-WPSYVJQVSA-N |
| XLogP | 1.94 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.83 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|