C20H32BrN3O5 — CID 23870404
(5R,6S,7R)-8-bromo-2-N-tert-butyl-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23870404) has the molecular formula C20H32BrN3O5 and a molecular weight of 474.40 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23870404 |
| Molecular Formula | C20H32BrN3O5 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-N-tert-butyl-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)NC(C)(C)C)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C20H32BrN3O5/c1-19(2,3)23-17(27)15-20-10-11(21)14(29-20)12(16(26)22-4)13(20)18(28)24(15)8-6-5-7-9-25/h11-15,25H,5-10H2,1-4H3,(H,22,26)(H,23,27)/t11?,12-,13-,14-,15?,20?/m0/s1 |
| InChIKey | SMXAHJPLLWWZKP-QQMLPKMBSA-N |
| XLogP | 0.56 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|