C27H30BrN3O5 — CID 23784266
(5R,6R,7S)-2-N,6-N-dibenzyl-8-bromo-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23784266) has the molecular formula C27H30BrN3O5 and a molecular weight of 556.46 g/mol. Its IUPAC name is (5R,6R,7S)-2-N,6-N-dibenzyl-8-bromo-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-2-N,6-N-dibenzyl-8-bromo-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23784266 |
| Molecular Formula | C27H30BrN3O5 |
| Molecular Weight | 556.46 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | (5R,6R,7S)-2-N,6-N-dibenzyl-8-bromo-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)C1N(CCCO)C(=O)[C@@H]2[C@@H](C(=O)NCc3ccccc3)[C@@H]3OC12CC3Br |
| InChI | InChI=1S/C27H30BrN3O5/c28-19-14-27-21(20(22(19)36-27)24(33)29-15-17-8-3-1-4-9-17)26(35)31(12-7-13-32)23(27)25(34)30-16-18-10-5-2-6-11-18/h1-6,8-11,19-23,32H,7,12-16H2,(H,29,33)(H,30,34)/t19?,20-,21+,22-,23?,27?/m1/s1 |
| InChIKey | WLIKEXFFZLNQKN-HSUZDRLVSA-N |
| XLogP | 1.75 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|