C29H35BrN4O5 — CID 23842250
(5R,6S,7R)-8-bromo-2-N-[4-(diethylamino)phenyl]-3-(3-hydroxypropyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23842250) has the molecular formula C29H35BrN4O5 and a molecular weight of 599.53 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-N-[4-(diethylamino)phenyl]-3-(3-hydroxypropyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-2-N-[4-(diethylamino)phenyl]-3-(3-hydroxypropyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23842250 |
| Molecular Formula | C29H35BrN4O5 |
| Molecular Weight | 599.53 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-N-[4-(diethylamino)phenyl]-3-(3-hydroxypropyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2N(CCCO)C(=O)[C@@H]3[C@H](C(=O)Nc4ccccc4)[C@H]4OC23CC4Br)cc1 |
| InChI | InChI=1S/C29H35BrN4O5/c1-3-33(4-2)20-13-11-19(12-14-20)32-27(37)25-29-17-21(30)24(39-29)22(23(29)28(38)34(25)15-8-16-35)26(36)31-18-9-6-5-7-10-18/h5-7,9-14,21-25,35H,3-4,8,15-17H2,1-2H3,(H,31,36)(H,32,37)/t21?,22-,23-,24-,25?,29?/m0/s1 |
| InChIKey | IZFVDXPDVFNGSH-MDLUKOLOSA-N |
| XLogP | 3.24 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|