C30H38N4O4S — CID 23953886
(5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-3-(3-hydroxypropyl)-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953886) has the molecular formula C30H38N4O4S and a molecular weight of 550.73 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-3-(3-hydroxypropyl)-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-3-(3-hydroxypropyl)-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953886 |
| Molecular Formula | C30H38N4O4S |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-3-(3-hydroxypropyl)-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2N(CCCO)C(=O)[C@@H]3[C@@H](C(=O)Nc4ccccc4)[C@H]4CC(C)C23S4)cc1 |
| InChI | InChI=1S/C30H38N4O4S/c1-4-33(5-2)22-14-12-21(13-15-22)32-28(37)26-30-19(3)18-23(39-30)24(25(30)29(38)34(26)16-9-17-35)27(36)31-20-10-7-6-8-11-20/h6-8,10-15,19,23-26,35H,4-5,9,16-18H2,1-3H3,(H,31,36)(H,32,37)/t19?,23-,24+,25+,26?,30?/m1/s1 |
| InChIKey | GMUDYSQVCQAVAT-FLYLOFKVSA-N |
| XLogP | 3.83 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|