C31H40N4O4S — CID 23926054
(5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23926054) has the molecular formula C31H40N4O4S and a molecular weight of 564.75 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23926054 |
| Molecular Formula | C31H40N4O4S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | (5S,6S,7R)-2-N-[4-(diethylamino)phenyl]-3-[(2S)-1-hydroxybutan-2-yl]-9-methyl-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@@H](CO)N1C(=O)[C@@H]2[C@@H](C(=O)Nc3ccccc3)[C@H]3CC(C)C2(S3)C1C(=O)Nc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C31H40N4O4S/c1-5-22(18-36)35-27(29(38)33-21-13-15-23(16-14-21)34(6-2)7-3)31-19(4)17-24(40-31)25(26(31)30(35)39)28(37)32-20-11-9-8-10-12-20/h8-16,19,22,24-27,36H,5-7,17-18H2,1-4H3,(H,32,37)(H,33,38)/t19?,22-,24+,25-,26-,27?,31?/m0/s1 |
| InChIKey | UVEWCQOLDNKQLY-HVLYDXOESA-N |
| XLogP | 4.22 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|