C29H42N4O5S — CID 23813150
(5S,6S,7R)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23813150) has the molecular formula C29H42N4O5S and a molecular weight of 558.75 g/mol. Its IUPAC name is (5S,6S,7R)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23813150 |
| Molecular Formula | C29H42N4O5S |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | (5S,6S,7R)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)C[C@H](CO)N1C(=O)[C@@H]2[C@@H](C(=O)Nc3ccccc3)[C@H]3CC(C)C2(S3)C1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C29H42N4O5S/c1-18(2)15-21(17-34)33-25(27(36)30-9-10-32-11-13-38-14-12-32)29-19(3)16-22(39-29)23(24(29)28(33)37)26(35)31-20-7-5-4-6-8-20/h4-8,18-19,21-25,34H,9-17H2,1-3H3,(H,30,36)(H,31,35)/t19?,21-,22-,23+,24+,25?,29?/m1/s1 |
| InChIKey | XUUPMBLJKNBPDD-SRJZVTMJSA-N |
| XLogP | 1.82 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |