C30H44N4O6S — CID 23841828
(5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23841828) has the molecular formula C30H44N4O6S and a molecular weight of 588.77 g/mol. Its IUPAC name is (5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23841828 |
| Molecular Formula | C30H44N4O6S |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | (5S,6S,7R)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N(CCCCCO)C(C(=O)NCCN4CCOCC4)C34S[C@@H]2CC4C)cc1 |
| InChI | InChI=1S/C30H44N4O6S/c1-3-40-22-9-7-21(8-10-22)32-27(36)24-23-19-20(2)30(41-23)25(24)29(38)34(12-5-4-6-16-35)26(30)28(37)31-11-13-33-14-17-39-18-15-33/h7-10,20,23-26,35H,3-6,11-19H2,1-2H3,(H,31,37)(H,32,36)/t20?,23-,24+,25+,26?,30?/m1/s1 |
| InChIKey | BAMFPCFYWNDINR-DWMONZCPSA-N |
| XLogP | 1.97 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|