C28H40N4O6S — CID 23783315
(5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23783315) has the molecular formula C28H40N4O6S and a molecular weight of 560.72 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23783315 |
| Molecular Formula | C28H40N4O6S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | (5S,6R,7S)-6-N-(4-ethoxyphenyl)-3-(4-hydroxybutyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@@H]3CCC4(S3)C(C(=O)NCCN3CCOCC3)N(CCCCO)C(=O)[C@H]24)cc1 |
| InChI | InChI=1S/C28H40N4O6S/c1-2-38-20-7-5-19(6-8-20)30-25(34)22-21-9-10-28(39-21)23(22)27(36)32(12-3-4-16-33)24(28)26(35)29-11-13-31-14-17-37-18-15-31/h5-8,21-24,33H,2-4,9-18H2,1H3,(H,29,35)(H,30,34)/t21-,22+,23-,24?,28?/m0/s1 |
| InChIKey | VVMUBEJOAHXNAW-NZJGDCIOSA-N |
| XLogP | 1.34 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|