C28H40N4O5S — CID 23869192
(5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869192) has the molecular formula C28H40N4O5S and a molecular weight of 544.72 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869192 |
| Molecular Formula | C28H40N4O5S |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | O=C(NCCN1CCOCC1)C1N(CCCCCO)C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@@H]3CCC12S3 |
| InChI | InChI=1S/C28H40N4O5S/c33-16-6-2-5-12-32-24(26(35)29-11-13-31-14-17-37-18-15-31)28-10-9-21(38-28)22(23(28)27(32)36)25(34)30-19-20-7-3-1-4-8-20/h1,3-4,7-8,21-24,33H,2,5-6,9-19H2,(H,29,35)(H,30,34)/t21-,22+,23-,24?,28?/m0/s1 |
| InChIKey | DDSSGNXCAPUWIJ-NZJGDCIOSA-N |
| XLogP | 1.00 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|