C29H42N4O5S — CID 23981363
(5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23981363) has the molecular formula C29H42N4O5S and a molecular weight of 558.75 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23981363 |
| Molecular Formula | C29H42N4O5S |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-3-(5-hydroxypentyl)-9-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC1C[C@@H]2SC13C(C(=O)NCCN1CCOCC1)N(CCCCCO)C(=O)[C@@H]3[C@@H]2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H42N4O5S/c1-20-18-22-23(26(35)31-19-21-8-4-2-5-9-21)24-28(37)33(11-6-3-7-15-34)25(29(20,24)39-22)27(36)30-10-12-32-13-16-38-17-14-32/h2,4-5,8-9,20,22-25,34H,3,6-7,10-19H2,1H3,(H,30,36)(H,31,35)/t20?,22-,23+,24-,25?,29?/m0/s1 |
| InChIKey | MYBJIRKFWSGSBB-DPKAFQLOSA-N |
| XLogP | 1.25 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|