C29H43N3O4S — CID 23925553
(5S,6R,7S)-6-N-benzyl-3-(6-hydroxyhexyl)-9-methyl-4-oxo-2-N-pentan-2-yl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23925553) has the molecular formula C29H43N3O4S and a molecular weight of 529.75 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-3-(6-hydroxyhexyl)-9-methyl-4-oxo-2-N-pentan-2-yl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-3-(6-hydroxyhexyl)-9-methyl-4-oxo-2-N-pentan-2-yl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23925553 |
| Molecular Formula | C29H43N3O4S |
| Molecular Weight | 529.75 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-3-(6-hydroxyhexyl)-9-methyl-4-oxo-2-N-pentan-2-yl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCC(C)NC(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@@H]3CC(C)C12S3 |
| InChI | InChI=1S/C29H43N3O4S/c1-4-12-20(3)31-27(35)25-29-19(2)17-22(37-29)23(26(34)30-18-21-13-8-7-9-14-21)24(29)28(36)32(25)15-10-5-6-11-16-33/h7-9,13-14,19-20,22-25,33H,4-6,10-12,15-18H2,1-3H3,(H,30,34)(H,31,35)/t19?,20?,22-,23+,24-,25?,29?/m0/s1 |
| InChIKey | UUXHTZZNKDAQGB-OJTUYQPWSA-N |
| XLogP | 3.50 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.75 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|