C29H41N3O4S — CID 23783726
(5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-(5-hydroxypentyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23783726) has the molecular formula C29H41N3O4S and a molecular weight of 527.73 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-(5-hydroxypentyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-(5-hydroxypentyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23783726 |
| Molecular Formula | C29H41N3O4S |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-2-N-cyclohexyl-3-(5-hydroxypentyl)-9-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC1C[C@@H]2SC13C(C(=O)NC1CCCCC1)N(CCCCCO)C(=O)[C@@H]3[C@@H]2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H41N3O4S/c1-19-17-22-23(26(34)30-18-20-11-5-2-6-12-20)24-28(36)32(15-9-4-10-16-33)25(29(19,24)37-22)27(35)31-21-13-7-3-8-14-21/h2,5-6,11-12,19,21-25,33H,3-4,7-10,13-18H2,1H3,(H,30,34)(H,31,35)/t19?,22-,23+,24-,25?,29?/m0/s1 |
| InChIKey | GIXMNBDYDLBLCX-BXODGKEHSA-N |
| XLogP | 3.25 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|