C27H36BrN3O5 — CID 23841978
(5R,6R,7S)-6-N-benzyl-8-bromo-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23841978) has the molecular formula C27H36BrN3O5 and a molecular weight of 562.51 g/mol. Its IUPAC name is (5R,6R,7S)-6-N-benzyl-8-bromo-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-6-N-benzyl-8-bromo-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23841978 |
| Molecular Formula | C27H36BrN3O5 |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | (5R,6R,7S)-6-N-benzyl-8-bromo-2-N-cyclohexyl-3-(4-hydroxybutyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | O=C(NC1CCCCC1)C1N(CCCCO)C(=O)[C@@H]2[C@@H](C(=O)NCc3ccccc3)[C@@H]3OC12CC3Br |
| InChI | InChI=1S/C27H36BrN3O5/c28-19-15-27-21(20(22(19)36-27)24(33)29-16-17-9-3-1-4-10-17)26(35)31(13-7-8-14-32)23(27)25(34)30-18-11-5-2-6-12-18/h1,3-4,9-10,18-23,32H,2,5-8,11-16H2,(H,29,33)(H,30,34)/t19?,20-,21+,22-,23?,27?/m1/s1 |
| InChIKey | MOWRVPMNRKNJLE-HSUZDRLVSA-N |
| XLogP | 2.27 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|