C25H33BrN2O6 — CID 23922868
ethyl (5R,6S,7R)-2-(benzylcarbamoyl)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23922868) has the molecular formula C25H33BrN2O6 and a molecular weight of 537.45 g/mol. Its IUPAC name is ethyl (5R,6S,7R)-2-(benzylcarbamoyl)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6S,7R)-2-(benzylcarbamoyl)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23922868 |
| Molecular Formula | C25H33BrN2O6 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | ethyl (5R,6S,7R)-2-(benzylcarbamoyl)-8-bromo-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)NCc3ccccc3)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C25H33BrN2O6/c1-2-33-24(32)18-19-23(31)28(12-8-3-4-9-13-29)21(25(19)14-17(26)20(18)34-25)22(30)27-15-16-10-6-5-7-11-16/h5-7,10-11,17-21,29H,2-4,8-9,12-15H2,1H3,(H,27,30)/t17?,18-,19-,20-,21?,25?/m0/s1 |
| InChIKey | RTCFUUJRJYEEPC-PCVVCRFLSA-N |
| XLogP | 2.17 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|