C29H40BrN3O5 — CID 23982184
(5R,6S,7R)-6-N-benzyl-8-bromo-2-N-cyclohexyl-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23982184) has the molecular formula C29H40BrN3O5 and a molecular weight of 590.56 g/mol. Its IUPAC name is (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-cyclohexyl-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-cyclohexyl-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23982184 |
| Molecular Formula | C29H40BrN3O5 |
| Molecular Weight | 590.56 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-cyclohexyl-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | O=C(NC1CCCCC1)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@H]3OC12CC3Br |
| InChI | InChI=1S/C29H40BrN3O5/c30-21-17-29-23(22(24(21)38-29)26(35)31-18-19-11-5-3-6-12-19)28(37)33(15-9-1-2-10-16-34)25(29)27(36)32-20-13-7-4-8-14-20/h3,5-6,11-12,20-25,34H,1-2,4,7-10,13-18H2,(H,31,35)(H,32,36)/t21?,22-,23-,24-,25?,29?/m0/s1 |
| InChIKey | MIBGUKDJZJGWCV-MDLUKOLOSA-N |
| XLogP | 3.05 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|