C26H27BrClN3O5 — CID 23954294
(5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23954294) has the molecular formula C26H27BrClN3O5 and a molecular weight of 576.88 g/mol. Its IUPAC name is (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23954294 |
| Molecular Formula | C26H27BrClN3O5 |
| Molecular Weight | 576.88 g/mol |
| Exact Mass | 575.08 |
| IUPAC Name | (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-(3-hydroxypropyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccccc1Cl)C1N(CCCO)C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@H]3OC12CC3Br |
| InChI | InChI=1S/C26H27BrClN3O5/c27-16-13-26-20(19(21(16)36-26)23(33)29-14-15-7-2-1-3-8-15)25(35)31(11-6-12-32)22(26)24(34)30-18-10-5-4-9-17(18)28/h1-5,7-10,16,19-22,32H,6,11-14H2,(H,29,33)(H,30,34)/t16?,19-,20-,21-,22?,26?/m0/s1 |
| InChIKey | OGWYKUXEIBIRKD-SFRHBPTASA-N |
| XLogP | 2.73 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.88 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|