C28H31BrClN3O5 — CID 23870401
(5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23870401) has the molecular formula C28H31BrClN3O5 and a molecular weight of 604.93 g/mol. Its IUPAC name is (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23870401 |
| Molecular Formula | C28H31BrClN3O5 |
| Molecular Weight | 604.93 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | (5R,6S,7R)-6-N-benzyl-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)[C@H](CO)N1C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@H]3OC2(CC3Br)C1C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C28H31BrClN3O5/c1-15(2)20(14-34)33-24(26(36)32-19-11-7-6-10-18(19)30)28-12-17(29)23(38-28)21(22(28)27(33)37)25(35)31-13-16-8-4-3-5-9-16/h3-11,15,17,20-24,34H,12-14H2,1-2H3,(H,31,35)(H,32,36)/t17?,20-,21-,22-,23-,24?,28?/m0/s1 |
| InChIKey | TXSADNWRNBVFHO-BIEXNMEISA-N |
| XLogP | 3.36 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.93 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|