C22H27BrClN3O4S — CID 23754753
(5S,6S,7S)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754753) has the molecular formula C22H27BrClN3O4S and a molecular weight of 544.90 g/mol. Its IUPAC name is (5S,6S,7S)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7S)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754753 |
| Molecular Formula | C22H27BrClN3O4S |
| Molecular Weight | 544.90 g/mol |
| Exact Mass | 543.06 |
| IUPAC Name | (5S,6S,7S)-8-bromo-2-N-(2-chlorophenyl)-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-6-N-methyl-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)Nc2ccccc2Cl)N([C@@H](CO)C(C)C)C(=O)[C@H]13 |
| InChI | InChI=1S/C22H27BrClN3O4S/c1-10(2)14(9-28)27-18(20(30)26-13-7-5-4-6-12(13)24)22-8-11(23)17(32-22)15(19(29)25-3)16(22)21(27)31/h4-7,10-11,14-18,28H,8-9H2,1-3H3,(H,25,29)(H,26,30)/t11?,14-,15+,16-,17+,18?,22?/m0/s1 |
| InChIKey | NXBMALIMBZWPPS-BBEUWFTASA-N |
| XLogP | 2.51 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.90 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|