C32H34BrN3O5 — CID 23784217
(5R,6R,7S)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-2-N-naphthalen-2-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23784217) has the molecular formula C32H34BrN3O5 and a molecular weight of 620.54 g/mol. Its IUPAC name is (5R,6R,7S)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-2-N-naphthalen-2-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-2-N-naphthalen-2-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23784217 |
| Molecular Formula | C32H34BrN3O5 |
| Molecular Weight | 620.54 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | (5R,6R,7S)-6-N-benzyl-8-bromo-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-2-N-naphthalen-2-yl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)[C@H](CO)N1C(=O)[C@@H]2[C@@H](C(=O)NCc3ccccc3)[C@@H]3OC2(CC3Br)C1C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H34BrN3O5/c1-18(2)24(17-37)36-28(30(39)35-22-13-12-20-10-6-7-11-21(20)14-22)32-15-23(33)27(41-32)25(26(32)31(36)40)29(38)34-16-19-8-4-3-5-9-19/h3-14,18,23-28,37H,15-17H2,1-2H3,(H,34,38)(H,35,39)/t23?,24-,25+,26-,27+,28?,32?/m0/s1 |
| InChIKey | PISUATQUNOHIHJ-DTVJMHCLSA-N |
| XLogP | 3.86 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|