C35H32BrN3O5 — CID 23784460
(5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23784460) has the molecular formula C35H32BrN3O5 and a molecular weight of 654.56 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23784460 |
| Molecular Formula | C35H32BrN3O5 |
| Molecular Weight | 654.56 g/mol |
| Exact Mass | 653.15 |
| IUPAC Name | (5R,6S,7R)-8-bromo-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)C1N([C@@H](CO)Cc2ccccc2)C(=O)[C@@H]2[C@H](C(=O)Nc3ccccc3)[C@H]3OC12CC3Br |
| InChI | InChI=1S/C35H32BrN3O5/c36-27-19-35-29(28(30(27)44-35)32(41)37-24-13-5-2-6-14-24)34(43)39(26(20-40)17-21-9-3-1-4-10-21)31(35)33(42)38-25-16-15-22-11-7-8-12-23(22)18-25/h1-16,18,26-31,40H,17,19-20H2,(H,37,41)(H,38,42)/t26-,27?,28+,29+,30+,31?,35?/m1/s1 |
| InChIKey | LSBNABCVZRSZQL-OPSAUHBASA-N |
| XLogP | 4.77 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|