C21H24BrClN2O6 — CID 23785443
ethyl (1R,2R,5S,6S,7R)-8-bromo-2-[(2-chlorophenyl)carbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23785443) has the molecular formula C21H24BrClN2O6 and a molecular weight of 515.79 g/mol. Its IUPAC name is ethyl (1R,2R,5S,6S,7R)-8-bromo-2-[(2-chlorophenyl)carbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (1R,2R,5S,6S,7R)-8-bromo-2-[(2-chlorophenyl)carbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23785443 |
| Molecular Formula | C21H24BrClN2O6 |
| Molecular Weight | 515.79 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | ethyl (1R,2R,5S,6S,7R)-8-bromo-2-[(2-chlorophenyl)carbamoyl]-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2O[C@@]3(CC2Br)[C@H](C(=O)Nc2ccccc2Cl)N([C@H](C)CO)C(=O)[C@@H]13 |
| InChI | InChI=1S/C21H24BrClN2O6/c1-3-30-20(29)14-15-19(28)25(10(2)9-26)17(21(15)8-11(22)16(14)31-21)18(27)24-13-7-5-4-6-12(13)23/h4-7,10-11,14-17,26H,3,8-9H2,1-2H3,(H,24,27)/t10-,11?,14+,15-,16+,17+,21-/m1/s1 |
| InChIKey | OYMAJIAQENQHMM-LFGIWAJOSA-N |
| XLogP | 1.97 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.79 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|