C28H40BrN3O6 — CID 23814529
ethyl (1S,2S,5R,6R,7S)-8-bromo-2-[[4-(diethylamino)phenyl]carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23814529) has the molecular formula C28H40BrN3O6 and a molecular weight of 594.55 g/mol. Its IUPAC name is ethyl (1S,2S,5R,6R,7S)-8-bromo-2-[[4-(diethylamino)phenyl]carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (1S,2S,5R,6R,7S)-8-bromo-2-[[4-(diethylamino)phenyl]carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23814529 |
| Molecular Formula | C28H40BrN3O6 |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | ethyl (1S,2S,5R,6R,7S)-8-bromo-2-[[4-(diethylamino)phenyl]carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2O[C@@]3(CC2Br)[C@@H]1C(=O)N([C@@H](CO)CC(C)C)[C@@H]3C(=O)Nc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C28H40BrN3O6/c1-6-31(7-2)18-11-9-17(10-12-18)30-25(34)24-28-14-20(29)23(38-28)21(27(36)37-8-3)22(28)26(35)32(24)19(15-33)13-16(4)5/h9-12,16,19-24,33H,6-8,13-15H2,1-5H3,(H,30,34)/t19-,20?,21-,22+,23-,24-,28+/m1/s1 |
| InChIKey | ZXIDIDHUWOYJCQ-ODNVPWDKSA-N |
| XLogP | 3.19 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|