C31H38BrN3O7 — CID 23755233
(5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23755233) has the molecular formula C31H38BrN3O7 and a molecular weight of 644.56 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23755233 |
| Molecular Formula | C31H38BrN3O7 |
| Molecular Weight | 644.56 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | (5R,6S,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-2-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N(C(CO)CC(C)C)C(C(=O)Nc4ccc(OC)cc4)C34CC(Br)[C@@H]2O4)cc1 |
| InChI | InChI=1S/C31H38BrN3O7/c1-5-41-22-12-8-18(9-13-22)33-28(37)24-25-30(39)35(20(16-36)14-17(2)3)27(31(25)15-23(32)26(24)42-31)29(38)34-19-6-10-21(40-4)11-7-19/h6-13,17,20,23-27,36H,5,14-16H2,1-4H3,(H,33,37)(H,34,38)/t20?,23?,24-,25-,26-,27?,31?/m0/s1 |
| InChIKey | MUSZOOKHACJYAT-HOBCWFFPSA-N |
| XLogP | 3.83 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|