C30H36BrN3O6 — CID 23898204
(5R,6R,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23898204) has the molecular formula C30H36BrN3O6 and a molecular weight of 614.54 g/mol. Its IUPAC name is (5R,6R,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23898204 |
| Molecular Formula | C30H36BrN3O6 |
| Molecular Weight | 614.54 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | (5R,6R,7S)-8-bromo-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@@H]3OC4(CC3Br)C(C(=O)Nc3cc(C)ccc3C)N(C(CC)CO)C(=O)[C@H]24)cc1 |
| InChI | InChI=1S/C30H36BrN3O6/c1-5-19(15-35)34-26(28(37)33-22-13-16(3)7-8-17(22)4)30-14-21(31)25(40-30)23(24(30)29(34)38)27(36)32-18-9-11-20(12-10-18)39-6-2/h7-13,19,21,23-26,35H,5-6,14-15H2,1-4H3,(H,32,36)(H,33,37)/t19?,21?,23-,24+,25-,26?,30?/m1/s1 |
| InChIKey | WCPQMIMJWIUXCT-SQLRSLKMSA-N |
| XLogP | 3.80 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|