C32H40BrN3O6 — CID 23898416
(5R,6S,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23898416) has the molecular formula C32H40BrN3O6 and a molecular weight of 642.59 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23898416 |
| Molecular Formula | C32H40BrN3O6 |
| Molecular Weight | 642.59 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N(CCCCCCO)C(C(=O)Nc4cc(C)ccc4C)C34CC(Br)[C@@H]2O4)cc1 |
| InChI | InChI=1S/C32H40BrN3O6/c1-4-41-22-13-11-21(12-14-22)34-29(38)25-26-31(40)36(15-7-5-6-8-16-37)28(32(26)18-23(33)27(25)42-32)30(39)35-24-17-19(2)9-10-20(24)3/h9-14,17,23,25-28,37H,4-8,15-16,18H2,1-3H3,(H,34,38)(H,35,39)/t23?,25-,26-,27-,28?,32?/m0/s1 |
| InChIKey | QUXXALWWLMEXQS-LNUZLMDYSA-N |
| XLogP | 4.58 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|